C13H16F3NO3 — CID 117236612
tert-butyl N-[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 117236612) has the molecular formula C13H16F3NO3 and a molecular weight of 291.27 g/mol. Its IUPAC name is tert-butyl N-[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 117236612 |
| Molecular Formula | C13H16F3NO3 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | tert-butyl N-[3-(hydroxymethyl)-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CO)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO3/c1-12(2,3)20-11(19)17-10-5-8(7-18)4-9(6-10)13(14,15)16/h4-6,18H,7H2,1-3H3,(H,17,19) |
| InChIKey | MFCRCSBJPCASRB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |