C12H11F3I3NO3 — CID 71169167
3,3,3-triiodopropyl N-[2-methoxy-5-(trifluoromethyl)phenyl]carbamate (PubChem CID 71169167) has the molecular formula C12H11F3I3NO3 and a molecular weight of 654.93 g/mol. Its IUPAC name is 3,3,3-triiodopropyl N-[2-methoxy-5-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 3,3,3-triiodopropyl N-[2-methoxy-5-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 71169167 |
| Molecular Formula | C12H11F3I3NO3 |
| Molecular Weight | 654.93 g/mol |
| Exact Mass | 654.78 |
| IUPAC Name | 3,3,3-triiodopropyl N-[2-methoxy-5-(trifluoromethyl)phenyl]carbamate |
| SMILES | COc1ccc(C(F)(F)F)cc1NC(=O)OCCC(I)(I)I |
| InChI | InChI=1S/C12H11F3I3NO3/c1-21-9-3-2-7(12(13,14)15)6-8(9)19-10(20)22-5-4-11(16,17)18/h2-3,6H,4-5H2,1H3,(H,19,20) |
| InChIKey | IHNKMZAGJQEZGD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.93 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|