C19H20F3NO5 — CID 2671998
3,5-dimethoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 2671998) has the molecular formula C19H20F3NO5 and a molecular weight of 399.37 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2671998 |
| Molecular Formula | C19H20F3NO5 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3,5-dimethoxy-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C19H20F3NO5/c1-25-6-7-28-17-5-4-13(19(20,21)22)10-16(17)23-18(24)12-8-14(26-2)11-15(9-12)27-3/h4-5,8-11H,6-7H2,1-3H3,(H,23,24) |
| InChIKey | UCSXIKWNJHRVPA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|