C16H11F6NO3 — CID 155291425
3-[2,5-bis(trifluoromethyl)anilino]-4-methoxybenzoic acid (PubChem CID 155291425) has the molecular formula C16H11F6NO3 and a molecular weight of 379.26 g/mol. Its IUPAC name is 3-[2,5-bis(trifluoromethyl)anilino]-4-methoxybenzoic acid.
| Compound Name | 3-[2,5-bis(trifluoromethyl)anilino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 155291425 |
| Molecular Formula | C16H11F6NO3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 3-[2,5-bis(trifluoromethyl)anilino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1Nc1cc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H11F6NO3/c1-26-13-5-2-8(14(24)25)6-12(13)23-11-7-9(15(17,18)19)3-4-10(11)16(20,21)22/h2-7,23H,1H3,(H,24,25) |
| InChIKey | IPPXIFUTRLJXRX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |