C22H15Cl2F2N3O2 — CID 10226585
1-(3,5-dichlorophenyl)-3-[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]urea (PubChem CID 10226585) has the molecular formula C22H15Cl2F2N3O2 and a molecular weight of 462.28 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]urea |
|---|---|
| PubChem CID | 10226585 |
| Molecular Formula | C22H15Cl2F2N3O2 |
| Molecular Weight | 462.28 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[5-(5,6-difluoro-1H-indol-2-yl)-2-methoxyphenyl]urea |
| SMILES | COc1ccc(-c2cc3cc(F)c(F)cc3[nH]2)cc1NC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H15Cl2F2N3O2/c1-31-21-3-2-11(18-6-12-4-16(25)17(26)10-19(12)28-18)5-20(21)29-22(30)27-15-8-13(23)7-14(24)9-15/h2-10,28H,1H3,(H2,27,29,30) |
| InChIKey | QGTKVBAXJSOQEO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.28 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |