C21H14F3N3O — CID 46381076
1-(2,4-difluorophenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea (PubChem CID 46381076) has the molecular formula C21H14F3N3O and a molecular weight of 381.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 46381076 |
| Molecular Formula | C21H14F3N3O |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2cc3cc(F)ccc3[nH]2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H14F3N3O/c22-14-3-7-18-13(9-14)10-20(26-18)12-1-5-16(6-2-12)25-21(28)27-19-8-4-15(23)11-17(19)24/h1-11,26H,(H2,25,27,28) |
| InChIKey | YDCVNYGTYCKADH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |