C21H15F2N3O — CID 46380900
1-(2,5-difluorophenyl)-3-[3-(1H-indol-2-yl)phenyl]urea (PubChem CID 46380900) has the molecular formula C21H15F2N3O and a molecular weight of 363.37 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[3-(1H-indol-2-yl)phenyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[3-(1H-indol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 46380900 |
| Molecular Formula | C21H15F2N3O |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[3-(1H-indol-2-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-c2cc3ccccc3[nH]2)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C21H15F2N3O/c22-15-8-9-17(23)20(12-15)26-21(27)24-16-6-3-5-13(10-16)19-11-14-4-1-2-7-18(14)25-19/h1-12,25H,(H2,24,26,27) |
| InChIKey | KHGQMIWHWSYVIJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |