C22H19N3O — CID 46380970
1-[4-(1H-indol-2-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 46380970) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[4-(1H-indol-2-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-(1H-indol-2-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 46380970 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[4-(1H-indol-2-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3cc4ccccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C22H19N3O/c1-15-5-4-7-19(13-15)24-22(26)23-18-11-9-16(10-12-18)21-14-17-6-2-3-8-20(17)25-21/h2-14,25H,1H3,(H2,23,24,26) |
| InChIKey | YRHQDAWAPJMZPC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |