C22H19N3O2 — CID 70903237
1-(4-hydroxyphenyl)-3-[2-(1H-indol-2-yl)-5-methylphenyl]urea (PubChem CID 70903237) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(4-hydroxyphenyl)-3-[2-(1H-indol-2-yl)-5-methylphenyl]urea.
| Compound Name | 1-(4-hydroxyphenyl)-3-[2-(1H-indol-2-yl)-5-methylphenyl]urea |
|---|---|
| PubChem CID | 70903237 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(4-hydroxyphenyl)-3-[2-(1H-indol-2-yl)-5-methylphenyl]urea |
| SMILES | Cc1ccc(-c2cc3ccccc3[nH]2)c(NC(=O)Nc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-14-6-11-18(21-13-15-4-2-3-5-19(15)24-21)20(12-14)25-22(27)23-16-7-9-17(26)10-8-16/h2-13,24,26H,1H3,(H2,23,25,27) |
| InChIKey | LJZVGLNDBBIIHR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|