C23H21N3O — CID 46384315
1-(2,5-dimethylphenyl)-3-[2-(1H-indol-2-yl)phenyl]urea (PubChem CID 46384315) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[2-(1H-indol-2-yl)phenyl]urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[2-(1H-indol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 46384315 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[2-(1H-indol-2-yl)phenyl]urea |
| SMILES | Cc1ccc(C)c(NC(=O)Nc2ccccc2-c2cc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C23H21N3O/c1-15-11-12-16(2)21(13-15)26-23(27)25-20-10-6-4-8-18(20)22-14-17-7-3-5-9-19(17)24-22/h3-14,24H,1-2H3,(H2,25,26,27) |
| InChIKey | AJKXHLCITLDSNU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |