C23H20FN3O — CID 46381042
1-(3,5-dimethylphenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea (PubChem CID 46381042) has the molecular formula C23H20FN3O and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 46381042 |
| Molecular Formula | C23H20FN3O |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-(5-fluoro-1H-indol-2-yl)phenyl]urea |
| SMILES | Cc1cc(C)cc(NC(=O)Nc2ccc(-c3cc4cc(F)ccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C23H20FN3O/c1-14-9-15(2)11-20(10-14)26-23(28)25-19-6-3-16(4-7-19)22-13-17-12-18(24)5-8-21(17)27-22/h3-13,27H,1-2H3,(H2,25,26,28) |
| InChIKey | PGRPAWZMLIGWQL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |