C22H18FN3OS — CID 46381079
1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 46381079) has the molecular formula C22H18FN3OS and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 46381079 |
| Molecular Formula | C22H18FN3OS |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)Nc2ccc(-c3cc4cc(F)ccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C22H18FN3OS/c1-28-19-4-2-3-18(13-19)25-22(27)24-17-8-5-14(6-9-17)21-12-15-11-16(23)7-10-20(15)26-21/h2-13,26H,1H3,(H2,24,25,27) |
| InChIKey | GVARKXWDBRDJLW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |