C22H17F2N3O — CID 46381077
1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-[(4-fluorophenyl)methyl]urea (PubChem CID 46381077) has the molecular formula C22H17F2N3O and a molecular weight of 377.39 g/mol. Its IUPAC name is 1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 46381077 |
| Molecular Formula | C22H17F2N3O |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 1-[4-(5-fluoro-1H-indol-2-yl)phenyl]-3-[(4-fluorophenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(F)cc1)Nc1ccc(-c2cc3cc(F)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H17F2N3O/c23-17-5-1-14(2-6-17)13-25-22(28)26-19-8-3-15(4-9-19)21-12-16-11-18(24)7-10-20(16)27-21/h1-12,27H,13H2,(H2,25,26,28) |
| InChIKey | RDRMCEYGZYNUQW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |