C22H18Cl2F3N3O2 — CID 71718728
1-[2-(2,4-dichlorophenoxy)-5-(trifluoromethyl)phenyl]-3-[4-(dimethylamino)phenyl]urea (PubChem CID 71718728) has the molecular formula C22H18Cl2F3N3O2 and a molecular weight of 484.31 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenoxy)-5-(trifluoromethyl)phenyl]-3-[4-(dimethylamino)phenyl]urea.
| Compound Name | 1-[2-(2,4-dichlorophenoxy)-5-(trifluoromethyl)phenyl]-3-[4-(dimethylamino)phenyl]urea |
|---|---|
| PubChem CID | 71718728 |
| Molecular Formula | C22H18Cl2F3N3O2 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 1-[2-(2,4-dichlorophenoxy)-5-(trifluoromethyl)phenyl]-3-[4-(dimethylamino)phenyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)Nc2cc(C(F)(F)F)ccc2Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2F3N3O2/c1-30(2)16-7-5-15(6-8-16)28-21(31)29-18-11-13(22(25,26)27)3-9-20(18)32-19-10-4-14(23)12-17(19)24/h3-12H,1-2H3,(H2,28,29,31) |
| InChIKey | DCAMRLQFFPBCGT-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|