C20H13Cl2F3N2O5S — CID 23211124
5-chloro-2-[4-chloro-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]benzenesulfonic acid (PubChem CID 23211124) has the molecular formula C20H13Cl2F3N2O5S and a molecular weight of 521.30 g/mol. Its IUPAC name is 5-chloro-2-[4-chloro-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]benzenesulfonic acid.
| Compound Name | 5-chloro-2-[4-chloro-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 23211124 |
| Molecular Formula | C20H13Cl2F3N2O5S |
| Molecular Weight | 521.30 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | 5-chloro-2-[4-chloro-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]benzenesulfonic acid |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H13Cl2F3N2O5S/c21-12-4-6-16(32-17-7-5-13(22)10-18(17)33(29,30)31)15(9-12)27-19(28)26-14-3-1-2-11(8-14)20(23,24)25/h1-10H,(H2,26,27,28)(H,29,30,31) |
| InChIKey | AYSVAELGTZNRKU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.30 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|