C21H17ClF3N3O3S — CID 34064102
1-[5-[(4-chlorophenyl)sulfamoyl]-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 34064102) has the molecular formula C21H17ClF3N3O3S and a molecular weight of 483.90 g/mol. Its IUPAC name is 1-[5-[(4-chlorophenyl)sulfamoyl]-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-[(4-chlorophenyl)sulfamoyl]-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 34064102 |
| Molecular Formula | C21H17ClF3N3O3S |
| Molecular Weight | 483.90 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | 1-[5-[(4-chlorophenyl)sulfamoyl]-2-methylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1NC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H17ClF3N3O3S/c1-13-5-10-18(32(30,31)28-16-8-6-15(22)7-9-16)12-19(13)27-20(29)26-17-4-2-3-14(11-17)21(23,24)25/h2-12,28H,1H3,(H2,26,27,29) |
| InChIKey | CGDCSIVLPULAHT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.90 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |