C18H18ClF3N2O3S — CID 2768785
2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 2768785) has the molecular formula C18H18ClF3N2O3S and a molecular weight of 434.87 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 2768785 |
| Molecular Formula | C18H18ClF3N2O3S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-3-methyl-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18ClF3N2O3S/c1-11(2)16(24-28(26,27)15-8-6-13(19)7-9-15)17(25)23-14-5-3-4-12(10-14)18(20,21)22/h3-11,16,24H,1-2H3,(H,23,25) |
| InChIKey | MYFGVAJUBWZBHR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |