C17H17F3N2O4S2 — CID 166186395
3-(cyclopropylsulfonylamino)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 166186395) has the molecular formula C17H17F3N2O4S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 3-(cyclopropylsulfonylamino)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | 3-(cyclopropylsulfonylamino)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166186395 |
| Molecular Formula | C17H17F3N2O4S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 3-(cyclopropylsulfonylamino)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C17H17F3N2O4S2/c1-11-5-6-15(10-16(11)22-27(23,24)14-7-8-14)28(25,26)21-13-4-2-3-12(9-13)17(18,19)20/h2-6,9-10,14,21-22H,7-8H2,1H3 |
| InChIKey | QSUGPPWGSASTKH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |