C6H4Cl4O3S — CID 88739685
sulfurochloridic acid;1,3,5-trichlorobenzene (PubChem CID 88739685) has the molecular formula C6H4Cl4O3S and a molecular weight of 297.97 g/mol. Its IUPAC name is sulfurochloridic acid;1,3,5-trichlorobenzene.
| Compound Name | sulfurochloridic acid;1,3,5-trichlorobenzene |
|---|---|
| PubChem CID | 88739685 |
| Molecular Formula | C6H4Cl4O3S |
| Molecular Weight | 297.97 g/mol |
| Exact Mass | 295.86 |
| IUPAC Name | sulfurochloridic acid;1,3,5-trichlorobenzene |
| SMILES | Clc1cc(Cl)cc(Cl)c1.O=S(=O)(O)Cl |
| InChI | InChI=1S/C6H3Cl3.ClHO3S/c7-4-1-5(8)3-6(9)2-4;1-5(2,3)4/h1-3H;(H,2,3,4) |
| InChIKey | GGNFXDSZEXDELX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|