C6H3Cl3 — CID 7950
1,3,5-trichlorobenzene (PubChem CID 7950) has the molecular formula C6H3Cl3 and a molecular weight of 181.45 g/mol. Its IUPAC name is 1,3,5-trichlorobenzene.
| Compound Name | 1,3,5-trichlorobenzene |
|---|---|
| PubChem CID | 7950 |
| Molecular Formula | C6H3Cl3 |
| Molecular Weight | 181.45 g/mol |
| Exact Mass | 179.93 |
| IUPAC Name | 1,3,5-trichlorobenzene |
| SMILES | Clc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C6H3Cl3/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | XKEFYDZQGKAQCN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |