C6H4Cl2 — CID 519913
1,2-dichloro-3,4,5,6-tetradeuteriobenzene (PubChem CID 519913) has the molecular formula C6H4Cl2 and a molecular weight of 151.03 g/mol. Its IUPAC name is 1,2-dichloro-3,4,5,6-tetradeuteriobenzene.
| Compound Name | 1,2-dichloro-3,4,5,6-tetradeuteriobenzene |
|---|---|
| PubChem CID | 519913 |
| Molecular Formula | C6H4Cl2 |
| Molecular Weight | 151.03 g/mol |
| Exact Mass | 149.99 |
| IUPAC Name | 1,2-dichloro-3,4,5,6-tetradeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(Cl)c(Cl)c1[2H] |
| InChI | InChI=1S/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H/i1D,2D,3D,4D |
| InChIKey | RFFLAFLAYFXFSW-RHQRLBAQSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.03 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |