C8H4Cl5NO — CID 4278652
2,2,2-trichloro-N-(3,5-dichlorophenyl)acetamide (PubChem CID 4278652) has the molecular formula C8H4Cl5NO and a molecular weight of 307.39 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4278652 |
| Molecular Formula | C8H4Cl5NO |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 304.87 |
| IUPAC Name | 2,2,2-trichloro-N-(3,5-dichlorophenyl)acetamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H4Cl5NO/c9-4-1-5(10)3-6(2-4)14-7(15)8(11,12)13/h1-3H,(H,14,15) |
| InChIKey | PAJDRXDZAGNFDG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|