C14H10Cl2N2O3 — CID 108502099
N'-(3,5-dichlorophenyl)-N-(4-hydroxyphenyl)oxamide (PubChem CID 108502099) has the molecular formula C14H10Cl2N2O3 and a molecular weight of 325.15 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-N-(4-hydroxyphenyl)oxamide.
| Compound Name | N'-(3,5-dichlorophenyl)-N-(4-hydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 108502099 |
| Molecular Formula | C14H10Cl2N2O3 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-N-(4-hydroxyphenyl)oxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N2O3/c15-8-5-9(16)7-11(6-8)18-14(21)13(20)17-10-1-3-12(19)4-2-10/h1-7,19H,(H,17,20)(H,18,21) |
| InChIKey | CQSARYBDCUCJNK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|