C10H7Cl2NO4 — CID 134117407
(E)-2,3-dichloro-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid (PubChem CID 134117407) has the molecular formula C10H7Cl2NO4 and a molecular weight of 276.08 g/mol. Its IUPAC name is (E)-2,3-dichloro-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-2,3-dichloro-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 134117407 |
| Molecular Formula | C10H7Cl2NO4 |
| Molecular Weight | 276.08 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (E)-2,3-dichloro-4-(4-hydroxyanilino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(Cl)=C(\Cl)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C10H7Cl2NO4/c11-7(8(12)10(16)17)9(15)13-5-1-3-6(14)4-2-5/h1-4,14H,(H,13,15)(H,16,17)/b8-7+ |
| InChIKey | OFTXGBWCWODSIG-BQYQJAHWSA-N |
| XLogP | 2.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.08 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|