C17H15ClN2O2 — CID 88680256
(E)-2-chloro-3-methyl-N,N'-diphenylbut-2-enediamide (PubChem CID 88680256) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is (E)-2-chloro-3-methyl-N,N'-diphenylbut-2-enediamide.
| Compound Name | (E)-2-chloro-3-methyl-N,N'-diphenylbut-2-enediamide |
|---|---|
| PubChem CID | 88680256 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (E)-2-chloro-3-methyl-N,N'-diphenylbut-2-enediamide |
| SMILES | C/C(C(=O)Nc1ccccc1)=C(\Cl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O2/c1-12(16(21)19-13-8-4-2-5-9-13)15(18)17(22)20-14-10-6-3-7-11-14/h2-11H,1H3,(H,19,21)(H,20,22)/b15-12+ |
| InChIKey | QKOCYHPMAJJRIC-NTCAYCPXSA-N |
| XLogP | 3.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|