About ethane;N-phenylcarbamoyl chloride
ethane;N-phenylcarbamoyl chloride (PubChem CID 91362970) has the molecular formula C9H12ClNO
and a molecular weight of 185.65 g/mol. Its IUPAC name is ethane;N-phenylcarbamoyl chloride.
Molecular Properties
| Compound Name | ethane;N-phenylcarbamoyl chloride |
| PubChem CID | 91362970 |
| Molecular Formula | C9H12ClNO |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | ethane;N-phenylcarbamoyl chloride |
| SMILES | CC.O=C(Cl)Nc1ccccc1 |
| InChI | InChI=1S/C7H6ClNO.C2H6/c8-7(10)9-6-4-2-1-3-5-6;1-2/h1-5H,(H,9,10);1-2H3 |
| InChIKey | VZDPFZTYZGEUMY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-phenylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-phenylcarbamoyl chloride?
The IUPAC name of ethane;N-phenylcarbamoyl chloride (CID 91362970) is ethane;N-phenylcarbamoyl chloride.
What is the SMILES notation for ethane;N-phenylcarbamoyl chloride?
The canonical SMILES for ethane;N-phenylcarbamoyl chloride is CC.O=C(Cl)Nc1ccccc1.
What is the InChIKey of ethane;N-phenylcarbamoyl chloride?
The InChIKey is VZDPFZTYZGEUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO.C2H6/c8-7(10)9-6-4-2-1-3-5-6;1-2/h1-5H,(H,9,10);1-2H3.
What are the key properties of ethane;N-phenylcarbamoyl chloride?
ethane;N-phenylcarbamoyl chloride has a molecular weight of 185.65 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-phenylcarbamoyl chloride is sourced from PubChem (CID 91362970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).