About N-anilinocarbamoyl chloride
N-anilinocarbamoyl chloride (PubChem CID 57449233) has the molecular formula C7H7ClN2O
and a molecular weight of 170.60 g/mol. Its IUPAC name is N-anilinocarbamoyl chloride.
Molecular Properties
| Compound Name | N-anilinocarbamoyl chloride |
| PubChem CID | 57449233 |
| Molecular Formula | C7H7ClN2O |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | N-anilinocarbamoyl chloride |
| SMILES | O=C(Cl)NNc1ccccc1 |
| InChI | InChI=1S/C7H7ClN2O/c8-7(11)10-9-6-4-2-1-3-5-6/h1-5,9H,(H,10,11) |
| InChIKey | SKDDQWHEAFGADN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-anilinocarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-anilinocarbamoyl chloride?
The IUPAC name of N-anilinocarbamoyl chloride (CID 57449233) is N-anilinocarbamoyl chloride.
What is the SMILES notation for N-anilinocarbamoyl chloride?
The canonical SMILES for N-anilinocarbamoyl chloride is O=C(Cl)NNc1ccccc1.
What is the InChIKey of N-anilinocarbamoyl chloride?
The InChIKey is SKDDQWHEAFGADN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O/c8-7(11)10-9-6-4-2-1-3-5-6/h1-5,9H,(H,10,11).
What are the key properties of N-anilinocarbamoyl chloride?
N-anilinocarbamoyl chloride has a molecular weight of 170.60 g/mol, XLogP of 1.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-anilinocarbamoyl chloride is sourced from PubChem (CID 57449233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).