About 2-fluoro-N'-phenylacetohydrazide
2-fluoro-N'-phenylacetohydrazide (PubChem CID 16862) has the molecular formula C8H9FN2O
and a molecular weight of 168.17 g/mol. Its IUPAC name is 2-fluoro-N'-phenylacetohydrazide.
Molecular Properties
| Compound Name | 2-fluoro-N'-phenylacetohydrazide |
| PubChem CID | 16862 |
| Molecular Formula | C8H9FN2O |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 2-fluoro-N'-phenylacetohydrazide |
| SMILES | O=C(CF)NNc1ccccc1 |
| InChI | InChI=1S/C8H9FN2O/c9-6-8(12)11-10-7-4-2-1-3-5-7/h1-5,10H,6H2,(H,11,12) |
| InChIKey | SNFXTZXIXWPTLF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N'-phenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N'-phenylacetohydrazide?
The IUPAC name of 2-fluoro-N'-phenylacetohydrazide (CID 16862) is 2-fluoro-N'-phenylacetohydrazide.
What is the SMILES notation for 2-fluoro-N'-phenylacetohydrazide?
The canonical SMILES for 2-fluoro-N'-phenylacetohydrazide is O=C(CF)NNc1ccccc1.
What is the InChIKey of 2-fluoro-N'-phenylacetohydrazide?
The InChIKey is SNFXTZXIXWPTLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN2O/c9-6-8(12)11-10-7-4-2-1-3-5-7/h1-5,10H,6H2,(H,11,12).
What are the key properties of 2-fluoro-N'-phenylacetohydrazide?
2-fluoro-N'-phenylacetohydrazide has a molecular weight of 168.17 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N'-phenylacetohydrazide is sourced from PubChem (CID 16862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).