About 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide
2-(2-hydroxyphenyl)-N'-phenylacetohydrazide (PubChem CID 23052266) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide.
Molecular Properties
| Compound Name | 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide |
| PubChem CID | 23052266 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1O)NNc1ccccc1 |
| InChI | InChI=1S/C14H14N2O2/c17-13-9-5-4-6-11(13)10-14(18)16-15-12-7-2-1-3-8-12/h1-9,15,17H,10H2,(H,16,18) |
| InChIKey | ZXLIZTXWMUZHNU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide?
The IUPAC name of 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide (CID 23052266) is 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide.
What is the SMILES notation for 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide?
The canonical SMILES for 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide is O=C(Cc1ccccc1O)NNc1ccccc1.
What is the InChIKey of 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide?
The InChIKey is ZXLIZTXWMUZHNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c17-13-9-5-4-6-11(13)10-14(18)16-15-12-7-2-1-3-8-12/h1-9,15,17H,10H2,(H,16,18).
What are the key properties of 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide?
2-(2-hydroxyphenyl)-N'-phenylacetohydrazide has a molecular weight of 242.28 g/mol, XLogP of 2.08, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyphenyl)-N'-phenylacetohydrazide is sourced from PubChem (CID 23052266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).