C20H26N4O2 — CID 14872757
1-N',8-N'-diphenyloctanedihydrazide (PubChem CID 14872757) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-N',8-N'-diphenyloctanedihydrazide.
| Compound Name | 1-N',8-N'-diphenyloctanedihydrazide |
|---|---|
| PubChem CID | 14872757 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-N',8-N'-diphenyloctanedihydrazide |
| SMILES | O=C(CCCCCCC(=O)NNc1ccccc1)NNc1ccccc1 |
| InChI | InChI=1S/C20H26N4O2/c25-19(23-21-17-11-5-3-6-12-17)15-9-1-2-10-16-20(26)24-22-18-13-7-4-8-14-18/h3-8,11-14,21-22H,1-2,9-10,15-16H2,(H,23,25)(H,24,26) |
| InChIKey | GRJNUMOXCZFCMY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|