About 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide
3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide (PubChem CID 102604414) has the molecular formula C15H15FN2OS
and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide |
| PubChem CID | 102604414 |
| Molecular Formula | C15H15FN2OS |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide |
| SMILES | O=C(CCSc1ccc(F)cc1)NNc1ccccc1 |
| InChI | InChI=1S/C15H15FN2OS/c16-12-6-8-14(9-7-12)20-11-10-15(19)18-17-13-4-2-1-3-5-13/h1-9,17H,10-11H2,(H,18,19) |
| InChIKey | AUQTZTLTTGPMNN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide?
The IUPAC name of 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide (CID 102604414) is 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide.
What is the SMILES notation for 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide?
The canonical SMILES for 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide is O=C(CCSc1ccc(F)cc1)NNc1ccccc1.
What is the InChIKey of 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide?
The InChIKey is AUQTZTLTTGPMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2OS/c16-12-6-8-14(9-7-12)20-11-10-15(19)18-17-13-4-2-1-3-5-13/h1-9,17H,10-11H2,(H,18,19).
What are the key properties of 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide?
3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide has a molecular weight of 290.36 g/mol, XLogP of 3.45, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)sulfanyl-N'-phenylpropanehydrazide is sourced from PubChem (CID 102604414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).