C15H15FN4O2S — CID 51282892
1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-pyridin-3-ylurea (PubChem CID 51282892) has the molecular formula C15H15FN4O2S and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-pyridin-3-ylurea.
| Compound Name | 1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 51282892 |
| Molecular Formula | C15H15FN4O2S |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-pyridin-3-ylurea |
| SMILES | O=C(CCSc1ccc(F)cc1)NNC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C15H15FN4O2S/c16-11-3-5-13(6-4-11)23-9-7-14(21)19-20-15(22)18-12-2-1-8-17-10-12/h1-6,8,10H,7,9H2,(H,19,21)(H2,18,20,22) |
| InChIKey | MLGNLCOTABHYQH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|