C19H18FN3O2S — CID 17485569
3-(4-fluorophenyl)sulfanyl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide (PubChem CID 17485569) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfanyl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide.
| Compound Name | 3-(4-fluorophenyl)sulfanyl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 17485569 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-(4-fluorophenyl)sulfanyl-N'-[2-(1H-indol-3-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCSc1ccc(F)cc1)NNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18FN3O2S/c20-14-5-7-15(8-6-14)26-10-9-18(24)22-23-19(25)11-13-12-21-17-4-2-1-3-16(13)17/h1-8,12,21H,9-11H2,(H,22,24)(H,23,25) |
| InChIKey | LXBIXCNDZJRYIW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|