C20H19FN2O3S — CID 41119824
(2S)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 41119824) has the molecular formula C20H19FN2O3S and a molecular weight of 386.45 g/mol. Its IUPAC name is (2S)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 41119824 |
| Molecular Formula | C20H19FN2O3S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2S)-2-[3-(4-fluorophenyl)sulfanylpropanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(CCSc1ccc(F)cc1)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H19FN2O3S/c21-14-5-7-15(8-6-14)27-10-9-19(24)23-18(20(25)26)11-13-12-22-17-4-2-1-3-16(13)17/h1-8,12,18,22H,9-11H2,(H,23,24)(H,25,26)/t18-/m0/s1 |
| InChIKey | CUYDLBXHNIKXFP-SFHVURJKSA-N |
| XLogP | 3.60 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |