About deuteriomethane;ethane;N-phenylacetamide
deuteriomethane;ethane;N-phenylacetamide (PubChem CID 91156750) has the molecular formula C11H19NO
and a molecular weight of 182.29 g/mol. Its IUPAC name is deuteriomethane;ethane;N-phenylacetamide.
Molecular Properties
| Compound Name | deuteriomethane;ethane;N-phenylacetamide |
| PubChem CID | 91156750 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | deuteriomethane;ethane;N-phenylacetamide |
| SMILES | CC.CC(=O)Nc1ccccc1.[2H]C |
| InChI | InChI=1S/C8H9NO.C2H6.CH4/c1-7(10)9-8-5-3-2-4-6-8;1-2;/h2-6H,1H3,(H,9,10);1-2H3;1H4/i;;1D |
| InChIKey | KMHGMQPXTIDGFQ-PRQZKWGPSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze deuteriomethane;ethane;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuteriomethane;ethane;N-phenylacetamide?
The IUPAC name of deuteriomethane;ethane;N-phenylacetamide (CID 91156750) is deuteriomethane;ethane;N-phenylacetamide.
What is the SMILES notation for deuteriomethane;ethane;N-phenylacetamide?
The canonical SMILES for deuteriomethane;ethane;N-phenylacetamide is CC.CC(=O)Nc1ccccc1.[2H]C.
What is the InChIKey of deuteriomethane;ethane;N-phenylacetamide?
The InChIKey is KMHGMQPXTIDGFQ-PRQZKWGPSA-N. The full InChI is InChI=1S/C8H9NO.C2H6.CH4/c1-7(10)9-8-5-3-2-4-6-8;1-2;/h2-6H,1H3,(H,9,10);1-2H3;1H4/i;;1D.
What are the key properties of deuteriomethane;ethane;N-phenylacetamide?
deuteriomethane;ethane;N-phenylacetamide has a molecular weight of 182.29 g/mol, XLogP of 3.31, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deuteriomethane;ethane;N-phenylacetamide is sourced from PubChem (CID 91156750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).