C15H12Cl2N2O2 — CID 14712481
2,2-dichloro-N,N'-diphenylpropanediamide (PubChem CID 14712481) has the molecular formula C15H12Cl2N2O2 and a molecular weight of 323.18 g/mol. Its IUPAC name is 2,2-dichloro-N,N'-diphenylpropanediamide.
| Compound Name | 2,2-dichloro-N,N'-diphenylpropanediamide |
|---|---|
| PubChem CID | 14712481 |
| Molecular Formula | C15H12Cl2N2O2 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2,2-dichloro-N,N'-diphenylpropanediamide |
| SMILES | O=C(Nc1ccccc1)C(Cl)(Cl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c16-15(17,13(20)18-11-7-3-1-4-8-11)14(21)19-12-9-5-2-6-10-12/h1-10H,(H,18,20)(H,19,21) |
| InChIKey | ULSGKBHIKTUMOQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|