C9H9NO5S — CID 175409791
3-(4-hydroxyanilino)-3-oxoprop-1-ene-2-sulfonic acid (PubChem CID 175409791) has the molecular formula C9H9NO5S and a molecular weight of 243.24 g/mol. Its IUPAC name is 3-(4-hydroxyanilino)-3-oxoprop-1-ene-2-sulfonic acid.
| Compound Name | 3-(4-hydroxyanilino)-3-oxoprop-1-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 175409791 |
| Molecular Formula | C9H9NO5S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 3-(4-hydroxyanilino)-3-oxoprop-1-ene-2-sulfonic acid |
| SMILES | C=C(C(=O)Nc1ccc(O)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C9H9NO5S/c1-6(16(13,14)15)9(12)10-7-2-4-8(11)5-3-7/h2-5,11H,1H2,(H,10,12)(H,13,14,15) |
| InChIKey | HBDVBMZNRPCFAT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|