C13H17NO4S — CID 174843507
4-(2-methylprop-2-enoylamino)benzenesulfonic acid;prop-1-ene (PubChem CID 174843507) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoylamino)benzenesulfonic acid;prop-1-ene.
| Compound Name | 4-(2-methylprop-2-enoylamino)benzenesulfonic acid;prop-1-ene |
|---|---|
| PubChem CID | 174843507 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-(2-methylprop-2-enoylamino)benzenesulfonic acid;prop-1-ene |
| SMILES | C=C(C)C(=O)Nc1ccc(S(=O)(=O)O)cc1.C=CC |
| InChI | InChI=1S/C10H11NO4S.C3H6/c1-7(2)10(12)11-8-3-5-9(6-4-8)16(13,14)15;1-3-2/h3-6H,1H2,2H3,(H,11,12)(H,13,14,15);3H,1H2,2H3 |
| InChIKey | UGGNZZUDMMJMEU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|