C7H8N2NaO4S — CID 87590877
Sodium 4-sulfophenylurea (PubChem CID 87590877) has the molecular formula C7H8N2NaO4S and a molecular weight of 239.21 g/mol.
| Compound Name | Sodium 4-sulfophenylurea |
|---|---|
| PubChem CID | 87590877 |
| Molecular Formula | C7H8N2NaO4S |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | — |
| SMILES | NC(=O)Nc1ccc(S(=O)(=O)O)cc1.[Na] |
| InChI | InChI=1S/C7H8N2O4S.Na/c8-7(10)9-5-1-3-6(4-2-5)14(11,12)13;/h1-4H,(H3,8,9,10)(H,11,12,13); |
| InChIKey | WGYUENQKWFVWMD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|