C10H9KN4O3S — CID 173442227
potassium;4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid;hydride (PubChem CID 173442227) has the molecular formula C10H9KN4O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is potassium;4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid;hydride.
| Compound Name | potassium;4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid;hydride |
|---|---|
| PubChem CID | 173442227 |
| Molecular Formula | C10H9KN4O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | potassium;4-[(1-amino-2,2-dicyanoethenyl)amino]benzenesulfonic acid;hydride |
| SMILES | N#CC(C#N)=C(N)Nc1ccc(S(=O)(=O)O)cc1.[H-].[K+] |
| InChI | InChI=1S/C10H8N4O3S.K.H/c11-5-7(6-12)10(13)14-8-1-3-9(4-2-8)18(15,16)17;;/h1-4,14H,13H2,(H,15,16,17);;/q;+1;-1 |
| InChIKey | KWOWFWAUMILBMM-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|