C10H11KN4O5S — CID 88779884
potassium;4-[(1,3-diamino-2-cyano-3-oxoprop-1-enyl)amino]benzenesulfonate;hydrate (PubChem CID 88779884) has the molecular formula C10H11KN4O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is potassium;4-[(1,3-diamino-2-cyano-3-oxoprop-1-enyl)amino]benzenesulfonate;hydrate.
| Compound Name | potassium;4-[(1,3-diamino-2-cyano-3-oxoprop-1-enyl)amino]benzenesulfonate;hydrate |
|---|---|
| PubChem CID | 88779884 |
| Molecular Formula | C10H11KN4O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | potassium;4-[(1,3-diamino-2-cyano-3-oxoprop-1-enyl)amino]benzenesulfonate;hydrate |
| SMILES | N#CC(C(N)=O)=C(N)Nc1ccc(S(=O)(=O)[O-])cc1.O.[K+] |
| InChI | InChI=1S/C10H10N4O4S.K.H2O/c11-5-8(10(13)15)9(12)14-6-1-3-7(4-2-6)19(16,17)18;;/h1-4,14H,12H2,(H2,13,15)(H,16,17,18);;1H2/q;+1;/p-1 |
| InChIKey | IUNBJDBUVIZFLJ-UHFFFAOYSA-M |
| XLogP | -4.64 |
| TPSA | 193.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|