C9H10KNO4S2 — CID 88792537
potassium 4-(2-sulfanylpropanoylamino)benzenesulfonate (PubChem CID 88792537) has the molecular formula C9H10KNO4S2 and a molecular weight of 299.41 g/mol. Its IUPAC name is potassium 4-(2-sulfanylpropanoylamino)benzenesulfonate.
| Compound Name | potassium 4-(2-sulfanylpropanoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 88792537 |
| Molecular Formula | C9H10KNO4S2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | potassium 4-(2-sulfanylpropanoylamino)benzenesulfonate |
| SMILES | CC(S)C(=O)Nc1ccc(S(=O)(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C9H11NO4S2.K/c1-6(15)9(11)10-7-2-4-8(5-3-7)16(12,13)14;/h2-6,15H,1H3,(H,10,11)(H,12,13,14);/q;+1/p-1 |
| InChIKey | HIKLJTRJDJRHMC-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|