C17H18NNaO4S2 — CID 23701624
sodium 4-[[2-[(4-methylphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate (PubChem CID 23701624) has the molecular formula C17H18NNaO4S2 and a molecular weight of 387.46 g/mol. Its IUPAC name is sodium 4-[[2-[(4-methylphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[2-[(4-methylphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 23701624 |
| Molecular Formula | C17H18NNaO4S2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | sodium 4-[[2-[(4-methylphenyl)methyl]-3-sulfanylpropanoyl]amino]benzenesulfonate |
| SMILES | Cc1ccc(CC(CS)C(=O)Nc2ccc(S(=O)(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C17H19NO4S2.Na/c1-12-2-4-13(5-3-12)10-14(11-23)17(19)18-15-6-8-16(9-7-15)24(20,21)22;/h2-9,14,23H,10-11H2,1H3,(H,18,19)(H,20,21,22);/q;+1/p-1 |
| InChIKey | OFIRTKYGQLSDKG-UHFFFAOYSA-M |
| XLogP | -0.37 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|