C19H17F3NNaO5S2 — CID 23701599
sodium 4-[[2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]benzenesulfonate (PubChem CID 23701599) has the molecular formula C19H17F3NNaO5S2 and a molecular weight of 483.47 g/mol. Its IUPAC name is sodium 4-[[2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]benzenesulfonate.
| Compound Name | sodium 4-[[2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]benzenesulfonate |
|---|---|
| PubChem CID | 23701599 |
| Molecular Formula | C19H17F3NNaO5S2 |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | sodium 4-[[2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoyl]amino]benzenesulfonate |
| SMILES | CC(=O)SCC(Cc1ccc(C(F)(F)F)cc1)C(=O)Nc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C19H18F3NO5S2.Na/c1-12(24)29-11-14(10-13-2-4-15(5-3-13)19(20,21)22)18(25)23-16-6-8-17(9-7-16)30(26,27)28;/h2-9,14H,10-11H2,1H3,(H,23,25)(H,26,27,28);/q;+1/p-1 |
| InChIKey | MYSZYLYCYGMBTH-UHFFFAOYSA-M |
| XLogP | 0.69 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|