C13H13F3O3S — CID 125468039
(2R)-2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 125468039) has the molecular formula C13H13F3O3S and a molecular weight of 306.31 g/mol. Its IUPAC name is (2R)-2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2R)-2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 125468039 |
| Molecular Formula | C13H13F3O3S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | (2R)-2-(acetylsulfanylmethyl)-3-[4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(=O)SC[C@H](Cc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C13H13F3O3S/c1-8(17)20-7-10(12(18)19)6-9-2-4-11(5-3-9)13(14,15)16/h2-5,10H,6-7H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | VSOHCJNVUNHPAQ-JTQLQIEISA-N |
| XLogP | 3.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|