C14H19NO3S — CID 129363581
(2R)-2-(acetylsulfanylmethyl)-3-[4-(dimethylamino)phenyl]propanoic acid (PubChem CID 129363581) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (2R)-2-(acetylsulfanylmethyl)-3-[4-(dimethylamino)phenyl]propanoic acid.
| Compound Name | (2R)-2-(acetylsulfanylmethyl)-3-[4-(dimethylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 129363581 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (2R)-2-(acetylsulfanylmethyl)-3-[4-(dimethylamino)phenyl]propanoic acid |
| SMILES | CC(=O)SC[C@H](Cc1ccc(N(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C14H19NO3S/c1-10(16)19-9-12(14(17)18)8-11-4-6-13(7-5-11)15(2)3/h4-7,12H,8-9H2,1-3H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | VUAWROMBPQWLGN-LBPRGKRZSA-N |
| XLogP | 2.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|