C6H10O3S2 — CID 154497388
(2R)-2-(acetylsulfanylmethyl)-3-sulfanylpropanoic acid (PubChem CID 154497388) has the molecular formula C6H10O3S2 and a molecular weight of 194.28 g/mol. Its IUPAC name is (2R)-2-(acetylsulfanylmethyl)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(acetylsulfanylmethyl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 154497388 |
| Molecular Formula | C6H10O3S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | (2R)-2-(acetylsulfanylmethyl)-3-sulfanylpropanoic acid |
| SMILES | CC(=O)SC[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H10O3S2/c1-4(7)11-3-5(2-10)6(8)9/h5,10H,2-3H2,1H3,(H,8,9)/t5-/m1/s1 |
| InChIKey | PXKKBEIPDBKGPW-RXMQYKEDSA-N |
| XLogP | 0.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|