C6H11NO3S — CID 175370345
(2R)-2-(acetamidomethyl)-3-sulfanylpropanoic acid (PubChem CID 175370345) has the molecular formula C6H11NO3S and a molecular weight of 177.22 g/mol. Its IUPAC name is (2R)-2-(acetamidomethyl)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(acetamidomethyl)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175370345 |
| Molecular Formula | C6H11NO3S |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | (2R)-2-(acetamidomethyl)-3-sulfanylpropanoic acid |
| SMILES | CC(=O)NC[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H11NO3S/c1-4(8)7-2-5(3-11)6(9)10/h5,11H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | XXBXJFCFJAAIHZ-YFKPBYRVSA-N |
| XLogP | -0.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|