2,8-bis(sulfanylmethyl)nonanedioic acid

C11H20O4S2 — CID 141431047

IUPAC2,8-bis(sulfanylmethyl)nonanedioic acid
SMILESO=C(O)C(CS)CCCCCC(CS)C(=O)O
InChIInChI=1S/C11H20O4S2/c12-10(13)8(6-16)4-2-1-3-5-9(7-17)11(14)15/h8-9,16-17H,1-7H2,(H,12,13)(H,14,15)
InChIKeyGCAYBJXCIVKXLD-UHFFFAOYSA-N
MW280.41 g/mol
LogP2.20
Rot. Bonds10

About 2,8-bis(sulfanylmethyl)nonanedioic acid

2,8-bis(sulfanylmethyl)nonanedioic acid (PubChem CID 141431047) has the molecular formula C11H20O4S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2,8-bis(sulfanylmethyl)nonanedioic acid.

Molecular Properties

Compound Name2,8-bis(sulfanylmethyl)nonanedioic acid
PubChem CID141431047
Molecular FormulaC11H20O4S2
Molecular Weight280.41 g/mol
Exact Mass280.08
IUPAC Name2,8-bis(sulfanylmethyl)nonanedioic acid
SMILESO=C(O)C(CS)CCCCCC(CS)C(=O)O
InChIInChI=1S/C11H20O4S2/c12-10(13)8(6-16)4-2-1-3-5-9(7-17)11(14)15/h8-9,16-17H,1-7H2,(H,12,13)(H,14,15)
InChIKeyGCAYBJXCIVKXLD-UHFFFAOYSA-N
XLogP2.20
TPSA74.60 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.41
LogP ≤ 52.20
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2,8-bis(sulfanylmethyl)nonanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-7-amino-2-(sulfanylmethyl)heptanoic acid
CID 71737799
sodium;hydride;4-sulfanyl-2-(sulfanylmethyl)butanoic acid
CID 175065659
6-phenyl-2-(sulfanylmethyl)hexanoic acid
CID 10900700
nonane-1,2,8,9-tetracarboxylic acid
CID 139878415
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid
CID 87560446
2-hexyl-8-sulfanyloctanoic acid
CID 20559914
2-(2-sulfanylethyl)icosanoic acid
CID 88820914
(2S)-2-heptyldecanoic acid
CID 171991627
2-heptadecylicosanoic acid
CID 57459073
2-nonyldodecanoic acid
CID 57283654
2-hexylpentacosanoic acid
CID 158257677
2-nonylpentadecanoic acid
CID 139605044

Frequently Asked Questions

What is the IUPAC name of 2,8-bis(sulfanylmethyl)nonanedioic acid?
The IUPAC name of 2,8-bis(sulfanylmethyl)nonanedioic acid (CID 141431047) is 2,8-bis(sulfanylmethyl)nonanedioic acid.
What is the SMILES notation for 2,8-bis(sulfanylmethyl)nonanedioic acid?
The canonical SMILES for 2,8-bis(sulfanylmethyl)nonanedioic acid is O=C(O)C(CS)CCCCCC(CS)C(=O)O.
What is the InChIKey of 2,8-bis(sulfanylmethyl)nonanedioic acid?
The InChIKey is GCAYBJXCIVKXLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4S2/c12-10(13)8(6-16)4-2-1-3-5-9(7-17)11(14)15/h8-9,16-17H,1-7H2,(H,12,13)(H,14,15).
What are the key properties of 2,8-bis(sulfanylmethyl)nonanedioic acid?
2,8-bis(sulfanylmethyl)nonanedioic acid has a molecular weight of 280.41 g/mol, XLogP of 2.20, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-bis(sulfanylmethyl)nonanedioic acid is sourced from PubChem (CID 141431047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).