About 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid (PubChem CID 87560446) has the molecular formula C19H34N4O2S
and a molecular weight of 382.57 g/mol. Its IUPAC name is 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid.
Molecular Properties
| Compound Name | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid |
| PubChem CID | 87560446 |
| Molecular Formula | C19H34N4O2S |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid |
| SMILES | CC(C)(C#N)/N=N/C(C)(C)C#N.CCCCCCCCC(CS)C(=O)O |
| InChI | InChI=1S/C11H22O2S.C8H12N4/c1-2-3-4-5-6-7-8-10(9-14)11(12)13;1-7(2,5-9)11-12-8(3,4)6-10/h10,14H,2-9H2,1H3,(H,12,13);1-4H3/b;12-11+ |
| InChIKey | OXKQZCPSXAXJTG-VPALRPFQSA-N |
| XLogP | 5.41 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid?
The IUPAC name of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid (CID 87560446) is 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid.
What is the SMILES notation for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid?
The canonical SMILES for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid is CC(C)(C#N)/N=N/C(C)(C)C#N.CCCCCCCCC(CS)C(=O)O.
What is the InChIKey of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid?
The InChIKey is OXKQZCPSXAXJTG-VPALRPFQSA-N. The full InChI is InChI=1S/C11H22O2S.C8H12N4/c1-2-3-4-5-6-7-8-10(9-14)11(12)13;1-7(2,5-9)11-12-8(3,4)6-10/h10,14H,2-9H2,1H3,(H,12,13);1-4H3/b;12-11+.
What are the key properties of 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid?
2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid has a molecular weight of 382.57 g/mol, XLogP of 5.41, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile;2-(sulfanylmethyl)decanoic acid is sourced from PubChem (CID 87560446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).